Groundbreaking Patterns: Algebraic, Categorical, and Reactive Synthesis

Groundbreaking Patterns: Synthesis of Algebraic, Categorical, and Reactive Design

Purpose: Derive novel architectural patterns by synthesizing category theory, algebra, domain-driven design, ports & adapters, finite state machines, functional reactive programming, and stream processing into groundbreaking designs that push the limits of elegant software architecture.

Core Thesis: By viewing software systems through multiple mathematical lenses simultaneously, we can derive patterns that are both theoretically sound and practically revolutionary.

Algebraic Port Systems
Categorical Domain Boundaries
Comonadic UI Architecture
Stream Processors as Profunctor Optics
Temporal Functors for FRP
Effect Handlers with Hexagonal Architecture
State Machines as Free Constructions
Reactive Domain Events as Natural Transformations
Algebraic Protocols
Meta-Architecture: The Grand Synthesis

Algebraic Port Systems

Innovation: Treat ports and adapters as algebraic structures with well-defined composition laws, enabling modular, testable, and mathematically sound integration architectures.

Foundation

Port as Algebra: A port is a signature defining operations without implementation.

Port P = (Operations, Laws)

Operations: Set of typed function signatures
Laws: Equational constraints on operations

Adapter as Algebra Homomorphism: An adapter is a structure-preserving map.

Adapter A: Port P₁ → Port P₂

∀ op₁ ∈ P₁.Operations, ∃ op₂ ∈ P₂.Operations:
  A(op₁(x)) = op₂(A(x))

Pattern: Composable Port Algebra

/// Port as algebraic signature
trait Port {
    type Request;
    type Response;
    type Error;

    fn call(&self, req: Self::Request) -> Result<Self::Response, Self::Error>;
}

/// Free algebra over a port - generates all valid operation sequences
enum FreePort<P: Port> {
    Pure(P::Response),
    Call(P::Request, Box<dyn Fn(P::Response) -> FreePort<P>>),
    Fail(P::Error),
}

impl<P: Port> FreePort<P> {
    /// Run the free port computation with an interpreter
    fn interpret<I: Port<Request = P::Request, Response = P::Response>>(
        self,
        interpreter: &I,
    ) -> Result<P::Response, P::Error> {
        match self {
            FreePort::Pure(resp) => Ok(resp),
            FreePort::Call(req, cont) => {
                let resp = interpreter.call(req)?;
                cont(resp).interpret(interpreter)
            }
            FreePort::Fail(err) => Err(err),
        }
    }

    /// Compose ports using coproduct (sum)
    fn coproduct<Q: Port>(self, other: FreePort<Q>) -> FreePort<Either<P, Q>> {
        // Implementation enables switching between ports
        todo!()
    }

    /// Tensor ports (parallel composition)
    fn tensor<Q: Port>(self, other: FreePort<Q>) -> FreePort<(P, Q)> {
        // Implementation enables concurrent execution
        todo!()
    }
}

/// Adapter as homomorphism
struct Adapter<P1: Port, P2: Port> {
    transform_request: Box<dyn Fn(P1::Request) -> P2::Request>,
    transform_response: Box<dyn Fn(P2::Response) -> P1::Response>,
    transform_error: Box<dyn Fn(P2::Error) -> P1::Error>,
}

impl<P1: Port, P2: Port> Adapter<P1, P2> {
    /// Verify homomorphism property
    fn verify_laws(&self, examples: Vec<P1::Request>) -> bool {
        // Test that adapter preserves port structure
        examples.iter().all(|req| {
            // Property: adapt(call(req)) = call(adapt(req))
            true // Implementation would check this
        })
    }

    /// Compose adapters (functor composition)
    fn compose<P3: Port>(self, other: Adapter<P2, P3>) -> Adapter<P1, P3> {
        Adapter {
            transform_request: Box::new(move |req| {
                other.transform_request.as_ref()(
                    self.transform_request.as_ref()(req)
                )
            }),
            transform_response: Box::new(move |resp| {
                self.transform_response.as_ref()(
                    other.transform_response.as_ref()(resp)
                )
            }),
            transform_error: Box::new(move |err| {
                self.transform_error.as_ref()(
                    other.transform_error.as_ref()(err)
                )
            }),
        }
    }
}

enum Either<A, B> {
    Left(A),
    Right(B),
}

TypeScript: Algebraic Port System

/**
 * Port as algebraic structure
 */
interface Port<Req, Resp, Err> {
  call(req: Req): Promise<Result<Resp, Err>>;
}

type Result<T, E> = { ok: true; value: T } | { ok: false; error: E };

/**
 * Free port algebra - all valid operation sequences
 */
type FreePort<Req, Resp, Err> =
  | { type: 'pure'; value: Resp }
  | { type: 'call'; request: Req; cont: (resp: Resp) => FreePort<Req, Resp, Err> }
  | { type: 'fail'; error: Err };

class FreePortBuilder<Req, Resp, Err> {
  static pure<Req, Resp, Err>(value: Resp): FreePort<Req, Resp, Err> {
    return { type: 'pure', value };
  }

  static call<Req, Resp, Err>(
    request: Req,
    cont: (resp: Resp) => FreePort<Req, Resp, Err>
  ): FreePort<Req, Resp, Err> {
    return { type: 'call', request, cont };
  }

  static fail<Req, Resp, Err>(error: Err): FreePort<Req, Resp, Err> {
    return { type: 'fail', error };
  }

  /**
   * Interpret free port with concrete implementation
   */
  static async interpret<Req, Resp, Err>(
    program: FreePort<Req, Resp, Err>,
    port: Port<Req, Resp, Err>
  ): Promise<Result<Resp, Err>> {
    switch (program.type) {
      case 'pure':
        return { ok: true, value: program.value };

      case 'call':
        const result = await port.call(program.request);
        if (!result.ok) {
          return result;
        }
        return this.interpret(program.cont(result.value), port);

      case 'fail':
        return { ok: false, error: program.error };
    }
  }

  /**
   * Coproduct (sum) of ports - either/or composition
   */
  static coproduct<Req1, Resp1, Err1, Req2, Resp2, Err2>(
    p1: FreePort<Req1, Resp1, Err1>,
    p2: FreePort<Req2, Resp2, Err2>
  ): FreePort<Req1 | Req2, Resp1 | Resp2, Err1 | Err2> {
    // Enable switching between ports at runtime
    return p1 as any; // Simplified
  }

  /**
   * Product (tensor) of ports - parallel composition
   */
  static product<Req1, Resp1, Err1, Req2, Resp2, Err2>(
    p1: FreePort<Req1, Resp1, Err1>,
    p2: FreePort<Req2, Resp2, Err2>
  ): FreePort<[Req1, Req2], [Resp1, Resp2], Err1 | Err2> {
    // Enable concurrent execution
    return p1 as any; // Simplified
  }
}

/**
 * Adapter as homomorphism between ports
 */
class PortAdapter<Req1, Resp1, Err1, Req2, Resp2, Err2> {
  constructor(
    private transformRequest: (req: Req1) => Req2,
    private transformResponse: (resp: Resp2) => Resp1,
    private transformError: (err: Err2) => Err1
  ) {}

  /**
   * Adapt a port to match another port's interface
   */
  adapt(port: Port<Req2, Resp2, Err2>): Port<Req1, Resp1, Err1> {
    return {
      call: async (req: Req1) => {
        const req2 = this.transformRequest(req);
        const result = await port.call(req2);

        if (result.ok) {
          return { ok: true, value: this.transformResponse(result.value) };
        } else {
          return { ok: false, error: this.transformError(result.error) };
        }
      },
    };
  }

  /**
   * Compose adapters (functor composition)
   */
  compose<Req3, Resp3, Err3>(
    other: PortAdapter<Req2, Resp2, Err2, Req3, Resp3, Err3>
  ): PortAdapter<Req1, Resp1, Err1, Req3, Resp3, Err3> {
    return new PortAdapter(
      (req: Req1) => other.transformRequest(this.transformRequest(req)),
      (resp: Resp3) => this.transformResponse(other.transformResponse(resp)),
      (err: Err3) => this.transformError(other.transformError(err))
    );
  }
}

/**
 * Example: HTTP to gRPC adapter
 */
interface HttpRequest {
  method: string;
  path: string;
  body: any;
}

interface GrpcRequest {
  service: string;
  method: string;
  message: any;
}

const httpToGrpc = new PortAdapter<
  HttpRequest,
  any,
  string,
  GrpcRequest,
  any,
  { code: number; message: string }
>(
  // Transform request
  (http) => ({
    service: 'UserService',
    method: http.method,
    message: http.body,
  }),
  // Transform response
  (grpcResp) => grpcResp,
  // Transform error
  (grpcErr) => `gRPC error ${grpcErr.code}: ${grpcErr.message}`
);

Key Innovation: By treating ports as algebraic structures, we gain:

Composability: Adapters compose like functions
Testability: Port laws can be verified automatically
Modularity: Swap implementations without changing interfaces
Reasoning: Equational reasoning about system behavior

Categorical Domain Boundaries

Innovation: Model bounded contexts as categories and context maps as functors, providing mathematical precision to domain-driven design.

Foundation

Bounded Context as Category:

Context C = (Objects, Morphisms, Composition, Identity)

Objects: Domain entities and value objects
Morphisms: Domain operations and transformations
Composition: Operation chaining within context
Identity: No-op operations

Context Map as Functor:

Functor F: Context C₁ → Context C₂

Preserves structure:
- F(id_A) = id_F(A)
- F(g ∘ f) = F(g) ∘ F(f)

Pattern: Functorial Context Mapping

use std::collections::HashMap;

/// Bounded context as category
trait BoundedContext {
    type Entity: Clone;
    type Operation;
    type Error;

    /// Apply operation to entity
    fn apply(
        &self,
        entity: Self::Entity,
        op: Self::Operation,
    ) -> Result<Self::Entity, Self::Error>;

    /// Compose operations
    fn compose(
        &self,
        op1: Self::Operation,
        op2: Self::Operation,
    ) -> Self::Operation;

    /// Identity operation
    fn identity(&self) -> Self::Operation;
}

/// Context map as functor
struct ContextMap<C1: BoundedContext, C2: BoundedContext> {
    map_entity: Box<dyn Fn(C1::Entity) -> C2::Entity>,
    map_operation: Box<dyn Fn(C1::Operation) -> C2::Operation>,
}

impl<C1: BoundedContext, C2: BoundedContext> ContextMap<C1, C2> {
    /// Verify functor laws
    fn verify_functor_laws(&self, ctx1: &C1, ctx2: &C2) -> bool {
        // Law 1: F(id) = id
        let id1 = ctx1.identity();
        let mapped_id = (self.map_operation)(id1);
        let id2 = ctx2.identity();
        // Check mapped_id == id2

        // Law 2: F(g ∘ f) = F(g) ∘ F(f)
        // Would need example operations to test

        true // Simplified
    }

    /// Transform entities across contexts
    fn transform(&self, entity: C1::Entity) -> C2::Entity {
        (self.map_entity)(entity)
    }

    /// Lift operations across contexts
    fn lift(&self, operation: C1::Operation) -> C2::Operation {
        (self.map_operation)(operation)
    }
}

/// Natural transformation between context maps
struct ContextTransformation<C1: BoundedContext, C2: BoundedContext> {
    /// For each entity in C1, provide transformation to C2
    components: HashMap<String, Box<dyn Fn(C1::Entity) -> C2::Entity>>,
}

impl<C1: BoundedContext, C2: BoundedContext> ContextTransformation<C1, C2> {
    /// Verify naturality condition
    fn verify_naturality(&self, ctx1: &C1, ctx2: &C2) -> bool {
        // For all f: A → B in C1 and η: F ⇒ G:
        // G(f) ∘ η_A = η_B ∘ F(f)
        true // Simplified
    }
}

/// Example: E-commerce contexts
#[derive(Clone, Debug)]
struct OrderContext;

#[derive(Clone, Debug)]
struct Order {
    id: String,
    items: Vec<String>,
    total: f64,
}

#[derive(Clone, Debug)]
enum OrderOperation {
    AddItem(String, f64),
    RemoveItem(String),
    ApplyDiscount(f64),
}

impl BoundedContext for OrderContext {
    type Entity = Order;
    type Operation = OrderOperation;
    type Error = String;

    fn apply(
        &self,
        mut entity: Order,
        op: OrderOperation,
    ) -> Result<Order, String> {
        match op {
            OrderOperation::AddItem(item, price) => {
                entity.items.push(item);
                entity.total += price;
                Ok(entity)
            }
            OrderOperation::RemoveItem(item) => {
                entity.items.retain(|i| i != &item);
                Ok(entity)
            }
            OrderOperation::ApplyDiscount(percent) => {
                entity.total *= 1.0 - (percent / 100.0);
                Ok(entity)
            }
        }
    }

    fn compose(&self, op1: OrderOperation, op2: OrderOperation) -> OrderOperation {
        // Simplified: would need more sophisticated composition
        op2
    }

    fn identity(&self) -> OrderOperation {
        OrderOperation::ApplyDiscount(0.0)
    }
}

#[derive(Clone, Debug)]
struct ShippingContext;

#[derive(Clone, Debug)]
struct Shipment {
    order_id: String,
    destination: String,
    weight: f64,
}

#[derive(Clone, Debug)]
enum ShippingOperation {
    SetDestination(String),
    CalculateWeight,
}

impl BoundedContext for ShippingContext {
    type Entity = Shipment;
    type Operation = ShippingOperation;
    type Error = String;

    fn apply(
        &self,
        mut entity: Shipment,
        op: ShippingOperation,
    ) -> Result<Shipment, String> {
        match op {
            ShippingOperation::SetDestination(dest) => {
                entity.destination = dest;
                Ok(entity)
            }
            ShippingOperation::CalculateWeight => {
                // Would calculate from order
                entity.weight = 2.5;
                Ok(entity)
            }
        }
    }

    fn compose(
        &self,
        op1: ShippingOperation,
        op2: ShippingOperation,
    ) -> ShippingOperation {
        op2
    }

    fn identity(&self) -> ShippingOperation {
        ShippingOperation::CalculateWeight
    }
}

/// Context map: Order → Shipping
fn order_to_shipping_map() -> ContextMap<OrderContext, ShippingContext> {
    ContextMap {
        map_entity: Box::new(|order| Shipment {
            order_id: order.id,
            destination: String::new(),
            weight: 0.0,
        }),
        map_operation: Box::new(|_op| ShippingOperation::CalculateWeight),
    }
}

Anti-Corruption Layer as Monad

/// Anti-corruption layer wraps external context in monad
struct AntiCorruptionLayer<External, Internal> {
    translate_in: Box<dyn Fn(External) -> Internal>,
    translate_out: Box<dyn Fn(Internal) -> External>,
    validate: Box<dyn Fn(&Internal) -> bool>,
}

impl<E, I> AntiCorruptionLayer<E, I> {
    /// Monadic bind - compose transformations with validation
    fn and_then<I2>(
        self,
        f: impl Fn(I) -> AntiCorruptionLayer<I, I2>,
    ) -> AntiCorruptionLayer<E, I2> {
        AntiCorruptionLayer {
            translate_in: Box::new(move |external| {
                let internal = (self.translate_in)(external);
                if (self.validate)(&internal) {
                    let layer2 = f(internal.clone());
                    (layer2.translate_in)(internal)
                } else {
                    panic!("Validation failed")
                }
            }),
            translate_out: Box::new(move |internal2| {
                // Reverse transformation
                todo!()
            }),
            validate: Box::new(|_| true),
        }
    }

    /// Functor map - transform internal representation
    fn map<I2>(self, f: impl Fn(I) -> I2 + 'static) -> AntiCorruptionLayer<E, I2> {
        AntiCorruptionLayer {
            translate_in: Box::new(move |external| {
                f((self.translate_in)(external))
            }),
            translate_out: Box::new(move |_internal2| {
                todo!()
            }),
            validate: Box::new(|_| true),
        }
    }
}

Key Innovation: By viewing contexts as categories:

Precision: Exact mathematical specification of context relationships
Verification: Functor laws ensure correctness
Composition: Natural transformations enable seamless integration
Evolution: Track context changes through categorical constructions

Comonadic UI Architecture

Innovation: Model UI components as comonads where components extract values from their context and extend computations over focused views.

Foundation

UI Component as Comonad:

Comonad W represents a component in its context

extract :: W a → a         (get current value)
duplicate :: W a → W (W a)  (all possible focuses)
extend :: (W a → b) → W a → W b  (compute over focuses)

Store Comonad for Position-Based UI:

Store s a = (s → a, s)  -- (getter, current position)

extract (Store f s) = f s
duplicate (Store f s) = Store (λs'. Store f s') s

Pattern: Comonadic Component Tree

/// UI Component as comonad
trait UIComponent: Clone {
    type Value;
    type Context;

    /// Extract current value
    fn extract(&self) -> Self::Value;

    /// Get all possible focuses (children, siblings, parents)
    fn duplicate(&self) -> Self;

    /// Extend computation over component tree
    fn extend<B, F>(&self, f: F) -> UIComponent<Value = B>
    where
        F: Fn(&Self) -> B;

    /// Get context
    fn context(&self) -> &Self::Context;
}

/// Store comonad for UI - position in component tree
#[derive(Clone)]
struct UIStore<S, A> {
    getter: fn(S) -> A,
    position: S,
}

impl<S: Clone, A: Clone> UIStore<S, A> {
    fn new(getter: fn(S) -> A, position: S) -> Self {
        UIStore { getter, position }
    }

    /// Extract value at current position
    fn extract(&self) -> A {
        (self.getter)(self.position.clone())
    }

    /// Peek at different position
    fn peek(&self, pos: S) -> A {
        (self.getter)(pos)
    }

    /// Move focus to new position
    fn seek(self, pos: S) -> Self {
        UIStore {
            getter: self.getter,
            position: pos,
        }
    }

    /// Duplicate into store of stores (all possible focuses)
    fn duplicate(&self) -> UIStore<S, UIStore<S, A>> {
        let getter = self.getter;
        UIStore {
            getter: move |s| UIStore::new(getter, s),
            position: self.position.clone(),
        }
    }

    /// Extend computation over all positions
    fn extend<B, F>(&self, f: F) -> UIStore<S, B>
    where
        F: Fn(&UIStore<S, A>) -> B,
    {
        let getter = self.getter;
        UIStore {
            getter: move |s| f(&UIStore::new(getter, s)),
            position: self.position.clone(),
        }
    }
}

/// Component tree position
#[derive(Clone, Debug)]
struct ComponentPath {
    indices: Vec<usize>,
}

impl ComponentPath {
    fn root() -> Self {
        ComponentPath { indices: vec![] }
    }

    fn child(&self, index: usize) -> Self {
        let mut indices = self.indices.clone();
        indices.push(index);
        ComponentPath { indices }
    }

    fn parent(&self) -> Option<Self> {
        if self.indices.is_empty() {
            None
        } else {
            let mut indices = self.indices.clone();
            indices.pop();
            Some(ComponentPath { indices })
        }
    }

    fn siblings(&self, count: usize) -> Vec<Self> {
        if let Some(parent) = self.parent() {
            (0..count).map(|i| parent.child(i)).collect()
        } else {
            vec![]
        }
    }
}

/// UI tree structure
#[derive(Clone, Debug)]
struct UITree {
    components: Vec<Component>,
}

#[derive(Clone, Debug)]
struct Component {
    id: String,
    props: Props,
    children: Vec<Component>,
}

#[derive(Clone, Debug)]
struct Props {
    enabled: bool,
    visible: bool,
    styles: Vec<String>,
}

/// Comonadic operations on UI tree
fn get_component(tree: &UITree, path: ComponentPath) -> Option<Component> {
    // Navigate tree by path
    todo!()
}

/// Example: Accessibility computation using extend
fn compute_accessibility(ui: &UIStore<ComponentPath, Props>) -> bool {
    let current = ui.extract();

    // Check if current component is accessible
    let self_accessible = current.enabled && current.visible;

    // Check parent accessibility
    let parent_accessible = ui
        .position
        .parent()
        .map(|p| ui.peek(p).enabled)
        .unwrap_or(true);

    // Check if any child is focused
    let child_focused = (0..5)
        .map(|i| ui.position.child(i))
        .any(|child_path| ui.peek(child_path).enabled);

    self_accessible && parent_accessible
}

/// Apply accessibility check to entire tree
fn mark_accessibility(tree: UIStore<ComponentPath, Props>) -> UIStore<ComponentPath, bool> {
    tree.extend(|store| compute_accessibility(store))
}

/// Example: Theme propagation using comonad
#[derive(Clone, Debug)]
enum Theme {
    Light,
    Dark,
}

fn propagate_theme(
    ui: &UIStore<ComponentPath, Component>,
    theme: Theme,
) -> UIStore<ComponentPath, Component> {
    ui.extend(|store| {
        let mut component = store.extract();

        // Apply theme to styles
        match theme {
            Theme::Dark => {
                component.props.styles.push("dark-mode".to_string());
            }
            Theme::Light => {
                component.props.styles.push("light-mode".to_string());
            }
        }

        component
    })
}

TypeScript: Comonadic React Components

/**
 * Comonad interface for UI
 */
interface UIComonad<A> {
  extract(): A;
  duplicate(): UIComonad<UIComonad<A>>;
  extend<B>(f: (wa: UIComonad<A>) => B): UIComonad<B>;
}

/**
 * Store comonad for component tree
 */
class ComponentStore<S, A> implements UIComonad<A> {
  constructor(
    private getter: (s: S) => A,
    private position: S
  ) {}

  extract(): A {
    return this.getter(this.position);
  }

  peek(pos: S): A {
    return this.getter(pos);
  }

  seek(pos: S): ComponentStore<S, A> {
    return new ComponentStore(this.getter, pos);
  }

  duplicate(): ComponentStore<S, ComponentStore<S, A>> {
    return new ComponentStore(
      (s: S) => new ComponentStore(this.getter, s),
      this.position
    );
  }

  extend<B>(f: (store: ComponentStore<S, A>) => B): ComponentStore<S, B> {
    return new ComponentStore(
      (s: S) => f(new ComponentStore(this.getter, s)),
      this.position
    );
  }
}

/**
 * Component path in tree
 */
class ComponentPath {
  constructor(private indices: number[] = []) {}

  static root(): ComponentPath {
    return new ComponentPath([]);
  }

  child(index: number): ComponentPath {
    return new ComponentPath([...this.indices, index]);
  }

  parent(): ComponentPath | null {
    if (this.indices.length === 0) return null;
    return new ComponentPath(this.indices.slice(0, -1));
  }

  siblings(count: number): ComponentPath[] {
    const parent = this.parent();
    if (!parent) return [];
    return Array.from({ length: count }, (_, i) => parent.child(i));
  }

  toString(): string {
    return this.indices.join('.');
  }
}

/**
 * Component state
 */
interface ComponentState {
  enabled: boolean;
  visible: boolean;
  focused: boolean;
  theme: 'light' | 'dark';
}

/**
 * Component tree
 */
interface ComponentTree {
  getComponent(path: ComponentPath): ComponentState | null;
  setComponent(path: ComponentPath, state: ComponentState): ComponentTree;
}

/**
 * Example: Compute derived state using comonadic extend
 */
function computeAccessibility(
  store: ComponentStore<ComponentPath, ComponentState>
): boolean {
  const current = store.extract();

  // Self accessibility
  const selfAccessible = current.enabled && current.visible;

  // Parent accessibility
  const parent = store['position'].parent();
  const parentAccessible = parent
    ? store.peek(parent).enabled
    : true;

  // Any child focused?
  const siblings = store['position'].siblings(5);
  const childFocused = siblings.some(path => store.peek(path).focused);

  return selfAccessible && parentAccessible;
}

/**
 * React hook for comonadic state
 */
function useComonadicComponent<S, A>(
  tree: ComponentTree,
  path: ComponentPath,
  getter: (path: ComponentPath) => A
): {
  value: A;
  extend: <B>(f: (store: ComponentStore<ComponentPath, A>) => B) => B;
  seek: (newPath: ComponentPath) => void;
} {
  const store = new ComponentStore(
    (p: ComponentPath) => getter(p),
    path
  );

  return {
    value: store.extract(),
    extend: <B>(f: (store: ComponentStore<ComponentPath, A>) => B) =>
      store.extend(f).extract(),
    seek: (newPath: ComponentPath) => {
      // Update component focus
      // This would trigger React re-render
    },
  };
}

/**
 * Example: Breadcrumb component using comonadic context
 */
function Breadcrumb({ path }: { path: ComponentPath }) {
  const { value, extend } = useComonadicComponent(
    null as any, // Would be actual tree
    path,
    (p) => ({ enabled: true, visible: true, focused: false, theme: 'light' as const })
  );

  // Compute breadcrumb trail using extend
  const trail = extend((store) => {
    const paths: ComponentPath[] = [];
    let current: ComponentPath | null = store['position'];

    while (current) {
      paths.unshift(current);
      current = current.parent();
    }

    return paths;
  });

  return (
    <nav>
      {trail.map((p, i) => (
        <span key={i}>
          {i > 0 && ' > '}
          {p.toString()}
        </span>
      ))}
    </nav>
  );
}

Key Innovation: Comonadic UI provides:

Local reasoning: Each component computes from its context
Composition: Extend naturally composes computations
Zippers: Navigate tree without rebuilding
Time-travel: Duplicate captures all possible states

Stream Processors as Profunctor Optics

Innovation: Model stream transformations as profunctor optics, enabling bidirectional data flow with precise type-level guarantees.

Foundation

Profunctor: Contravariant in input, covariant in output

class Profunctor p where
  dimap :: (a' → a) → (b → b') → p a b → p a' b'

Stream as Profunctor:

Stream :: * → * → *
Stream i o = i → Maybe (o, Stream i o)

Optic as Polymorphic Lens:

type Optic p s t a b = p a b → p s t

Pattern: Stream Optics

/// Profunctor trait
trait Profunctor {
    type Input;
    type Output;

    fn dimap<I2, O2, F, G>(self, f: F, g: G) -> impl Profunctor<Input = I2, Output = O2>
    where
        F: Fn(I2) -> Self::Input,
        G: Fn(Self::Output) -> O2;
}

/// Stream processor as profunctor
struct StreamProc<I, O> {
    process: Box<dyn FnMut(I) -> Option<(O, StreamProc<I, O>)>>,
}

impl<I, O> Profunctor for StreamProc<I, O> {
    type Input = I;
    type Output = O;

    fn dimap<I2, O2, F, G>(mut self, f: F, g: G) -> StreamProc<I2, O2>
    where
        F: Fn(I2) -> I + 'static,
        G: Fn(O) -> O2 + 'static,
    {
        StreamProc {
            process: Box::new(move |i2| {
                let i = f(i2);
                (self.process)(i).map(|(o, next)| {
                    let o2 = g(o);
                    (o2, next.dimap(f, g))
                })
            }),
        }
    }
}

/// Lens for streams - focus on part of message
struct StreamLens<S, T, A, B> {
    view: Box<dyn Fn(&S) -> A>,
    update: Box<dyn Fn(S, B) -> T>,
}

impl<S, T, A, B> StreamLens<S, T, A, B> {
    /// Apply lens to stream processor
    fn apply<P: Profunctor<Input = A, Output = B>>(
        &self,
        processor: P,
    ) -> impl Profunctor<Input = S, Output = T> {
        // Lift processor through lens
        processor.dimap(
            move |s| (self.view)(&s),
            move |b| {
                // Need access to original S - would need to refine type
                todo!()
            },
        )
    }
}

/// Prism for streams - handle alternatives
struct StreamPrism<S, T, A, B> {
    match_input: Box<dyn Fn(S) -> Result<A, S>>,
    build_output: Box<dyn Fn(B) -> T>,
}

impl<S, T, A, B> StreamPrism<S, T, A, B> {
    /// Apply prism to stream processor
    fn apply<P: Profunctor<Input = A, Output = B>>(
        &self,
        processor: P,
    ) -> impl Profunctor<Input = S, Output = T> {
        StreamProc {
            process: Box::new(move |s| {
                match (self.match_input)(s) {
                    Ok(a) => {
                        // Process matched value
                        todo!()
                    }
                    Err(_) => {
                        // Skip unmatched value
                        None
                    }
                }
            }),
        }
    }
}

/// Arrow-based stream processor composition
trait StreamArrow: Profunctor {
    /// arr - lift pure function
    fn arr<F>(f: F) -> Self
    where
        F: Fn(Self::Input) -> Self::Output + 'static;

    /// Compose sequentially
    fn compose<P2: StreamArrow>(self, other: P2) -> impl StreamArrow
    where
        Self::Output: Into<P2::Input>;

    /// Parallel composition (both)
    fn both<P2: StreamArrow>(self, other: P2) -> impl StreamArrow;

    /// Choice composition (either)
    fn either<P2: StreamArrow>(self, other: P2) -> impl StreamArrow;
}

/// Example: HTTP request stream processing
#[derive(Clone, Debug)]
struct Request {
    method: String,
    path: String,
    headers: Vec<(String, String)>,
    body: Vec<u8>,
}

#[derive(Clone, Debug)]
struct Response {
    status: u16,
    headers: Vec<(String, String)>,
    body: Vec<u8>,
}

/// Lens into request headers
fn header_lens(key: String) -> StreamLens<Request, Request, Option<String>, Option<String>> {
    StreamLens {
        view: Box::new(move |req| {
            req.headers
                .iter()
                .find(|(k, _)| k == &key)
                .map(|(_, v)| v.clone())
        }),
        update: Box::new(move |mut req, value| {
            // Update or add header
            if let Some(val) = value {
                req.headers.retain(|(k, _)| k != &key);
                req.headers.push((key.clone(), val));
            }
            req
        }),
    }
}

/// Prism for GET requests
fn get_prism() -> StreamPrism<Request, Response, Request, Response> {
    StreamPrism {
        match_input: Box::new(|req| {
            if req.method == "GET" {
                Ok(req)
            } else {
                Err(req)
            }
        }),
        build_output: Box::new(|resp| resp),
    }
}

/// Build stream pipeline with optics
fn build_http_pipeline() {
    // Create processors
    let auth_processor = StreamProc {
        process: Box::new(|req: Request| {
            // Check auth header
            todo!()
        }),
    };

    let cache_processor = StreamProc {
        process: Box::new(|req: Request| {
            // Check cache
            todo!()
        }),
    };

    // Compose with optics
    let pipeline = header_lens("Authorization".to_string())
        .apply(auth_processor);
    // .compose(get_prism().apply(cache_processor));
}

TypeScript: Profunctor Stream Processing

/**
 * Profunctor interface
 */
interface Profunctor<I, O> {
  dimap<I2, O2>(f: (i2: I2) => I, g: (o: O) => O2): Profunctor<I2, O2>;
}

/**
 * Stream processor as profunctor
 */
class StreamProc<I, O> implements Profunctor<I, O> {
  constructor(
    private process: (input: I) => AsyncIterator<O>
  ) {}

  async *run(inputs: AsyncIterable<I>): AsyncIterableIterator<O> {
    for await (const input of inputs) {
      yield* this.process(input);
    }
  }

  dimap<I2, O2>(
    f: (i2: I2) => I,
    g: (o: O) => O2
  ): StreamProc<I2, O2> {
    return new StreamProc(async function* (i2: I2) {
      const i = f(i2);
      const outputs = this.process(i);
      for await (const o of outputs) {
        yield g(o);
      }
    }.bind(this));
  }

  /**
   * Compose stream processors
   */
  compose<O2>(other: StreamProc<O, O2>): StreamProc<I, O2> {
    return new StreamProc(async function* (input: I) {
      const intermediates = this.process(input);
      for await (const intermediate of intermediates) {
        yield* other.process(intermediate);
      }
    }.bind(this));
  }

  /**
   * Parallel composition - both
   */
  both<I2, O2>(other: StreamProc<I2, O2>): StreamProc<[I, I2], [O, O2]> {
    return new StreamProc(async function* ([i1, i2]: [I, I2]) {
      const outputs1 = Array.from(this.process(i1));
      const outputs2 = Array.from(other.process(i2));

      // Simplified: would need proper async coordination
      for (let i = 0; i < Math.min(outputs1.length, outputs2.length); i++) {
        yield [await outputs1[i], await outputs2[i]];
      }
    }.bind(this));
  }
}

/**
 * Lens for stream data
 */
class StreamLens<S, T, A, B> {
  constructor(
    private view: (s: S) => A,
    private update: (s: S, b: B) => T
  ) {}

  /**
   * Apply lens to stream processor
   */
  apply(processor: StreamProc<A, B>): StreamProc<S, T> {
    return new StreamProc(async function* (s: S) {
      const a = this.view(s);
      const outputs = processor.process(a);

      for await (const b of outputs) {
        yield this.update(s, b);
      }
    }.bind(this));
  }

  /**
   * Compose lenses
   */
  compose<C, D>(other: StreamLens<A, B, C, D>): StreamLens<S, T, C, D> {
    return new StreamLens(
      (s: S) => other.view(this.view(s)),
      (s: S, d: D) => this.update(s, other.update(this.view(s), d))
    );
  }
}

/**
 * Prism for stream alternatives
 */
class StreamPrism<S, T, A, B> {
  constructor(
    private match: (s: S) => A | null,
    private build: (b: B) => T
  ) {}

  /**
   * Apply prism to stream processor
   */
  apply(processor: StreamProc<A, B>): StreamProc<S, T> {
    return new StreamProc(async function* (s: S) {
      const matched = this.match(s);
      if (matched !== null) {
        const outputs = processor.process(matched);
        for await (const b of outputs) {
          yield this.build(b);
        }
      }
      // Else: skip unmatched values
    }.bind(this));
  }
}

/**
 * Example: WebSocket message processing
 */
interface WSMessage {
  type: string;
  payload: any;
  metadata: {
    timestamp: number;
    userId?: string;
  };
}

interface ProcessedMessage {
  type: string;
  result: any;
  metadata: {
    timestamp: number;
    userId?: string;
    processedAt: number;
  };
}

/**
 * Lens into message metadata
 */
const metadataLens = new StreamLens<
  WSMessage,
  ProcessedMessage,
  WSMessage['metadata'],
  ProcessedMessage['metadata']
>(
  (msg) => msg.metadata,
  (msg, meta) => ({
    type: msg.type,
    result: msg.payload,
    metadata: meta,
  })
);

/**
 * Prism for authenticated messages
 */
const authPrism = new StreamPrism<WSMessage, ProcessedMessage, WSMessage, ProcessedMessage>(
  (msg) => (msg.metadata.userId ? msg : null),
  (processed) => processed
);

/**
 * Build processing pipeline
 */
const authProcessor = new StreamProc<WSMessage, ProcessedMessage>(
  async function* (msg) {
    // Verify authentication
    if (msg.metadata.userId) {
      yield {
        type: msg.type,
        result: msg.payload,
        metadata: {
          ...msg.metadata,
          processedAt: Date.now(),
        },
      };
    }
  }
);

const timestampProcessor = new StreamProc<ProcessedMessage, ProcessedMessage>(
  async function* (msg) {
    yield {
      ...msg,
      metadata: {
        ...msg.metadata,
        processedAt: Date.now(),
      },
    };
  }
);

// Compose pipeline with optics
const pipeline = authPrism
  .apply(authProcessor)
  .compose(timestampProcessor);

/**
 * Run pipeline
 */
async function processWebSocketStream(
  messages: AsyncIterable<WSMessage>
): AsyncIterable<ProcessedMessage> {
  return pipeline.run(messages);
}

Key Innovation: Stream optics enable:

Compositional pipelines: Lenses and prisms compose naturally
Bidirectional flow: Same optic works for input/output
Type safety: Profunctor laws ensure correctness
Modularity: Focus on parts of messages independently

Temporal Functors for FRP

Innovation: Model time-varying values as functors that automatically handle temporal dependencies and update propagation.

Foundation

Behavior as Functor Over Time:

Behavior a = Time → a

fmap :: (a → b) → Behavior a → Behavior b
fmap f ba = \t → f (ba t)

Event as Applicative:

Event a = [(Time, a)]

pure :: a → Event a
(<*>) :: Event (a → b) → Event a → Event b

Pattern: Temporal Algebra

use std::time::{Duration, Instant};
use std::collections::BTreeMap;

/// Time type
type Time = Instant;

/// Behavior - continuous time-varying value
struct Behavior<A> {
    sample: Box<dyn Fn(Time) -> A>,
}

impl<A> Behavior<A> {
    fn new<F>(sample: F) -> Self
    where
        F: Fn(Time) -> A + 'static,
    {
        Behavior {
            sample: Box::new(sample),
        }
    }

    /// Sample behavior at specific time
    fn at(&self, time: Time) -> A {
        (self.sample)(time)
    }

    /// Functor: map over values
    fn map<B, F>(self, f: F) -> Behavior<B>
    where
        F: Fn(A) -> B + 'static,
        A: 'static,
    {
        Behavior::new(move |t| f(self.at(t)))
    }

    /// Applicative: apply time-varying function
    fn ap<B, F>(self, bf: Behavior<F>) -> Behavior<B>
    where
        F: Fn(A) -> B + 'static,
        A: 'static,
    {
        Behavior::new(move |t| {
            let f = bf.at(t);
            let a = self.at(t);
            f(a)
        })
    }

    /// Monad: switch behaviors over time
    fn flat_map<B, F>(self, f: F) -> Behavior<B>
    where
        F: Fn(A) -> Behavior<B> + 'static,
        A: 'static,
    {
        Behavior::new(move |t| {
            let a = self.at(t);
            let bb = f(a);
            bb.at(t)
        })
    }
}

/// Event - discrete occurrences
struct Event<A> {
    occurrences: BTreeMap<Time, Vec<A>>,
}

impl<A: Clone> Event<A> {
    fn new() -> Self {
        Event {
            occurrences: BTreeMap::new(),
        }
    }

    /// Emit value at time
    fn emit(&mut self, time: Time, value: A) {
        self.occurrences
            .entry(time)
            .or_insert_with(Vec::new)
            .push(value);
    }

    /// Get occurrences in time range
    fn between(&self, start: Time, end: Time) -> Vec<(Time, A)> {
        self.occurrences
            .range(start..end)
            .flat_map(|(t, values)| {
                values.iter().map(move |v| (*t, v.clone()))
            })
            .collect()
    }

    /// Functor: map over values
    fn map<B, F>(self, f: F) -> Event<B>
    where
        F: Fn(A) -> B + Clone,
        B: Clone,
    {
        Event {
            occurrences: self
                .occurrences
                .into_iter()
                .map(|(t, values)| {
                    (t, values.into_iter().map(|v| f(v)).collect())
                })
                .collect(),
        }
    }

    /// Merge two event streams
    fn merge(mut self, other: Event<A>) -> Event<A> {
        for (time, values) in other.occurrences {
            self.occurrences
                .entry(time)
                .or_insert_with(Vec::new)
                .extend(values);
        }
        self
    }

    /// Filter events by predicate
    fn filter<F>(self, pred: F) -> Event<A>
    where
        F: Fn(&A) -> bool,
    {
        Event {
            occurrences: self
                .occurrences
                .into_iter()
                .map(|(t, values)| {
                    (t, values.into_iter().filter(|v| pred(v)).collect())
                })
                .filter(|(_, values)| !values.is_empty())
                .collect(),
        }
    }

    /// Accumulate events into behavior
    fn accumulate<B, F>(self, initial: B, f: F) -> Behavior<B>
    where
        B: Clone + 'static,
        F: Fn(B, A) -> B + 'static,
        A: 'static,
    {
        let occurrences = self.occurrences;
        Behavior::new(move |t| {
            let mut acc = initial.clone();
            for (time, values) in occurrences.range(..=t) {
                for value in values {
                    acc = f(acc.clone(), value.clone());
                }
            }
            acc
        })
    }
}

/// Temporal algebra - combine behaviors and events
struct TemporalAlgebra;

impl TemporalAlgebra {
    /// Sample behavior at event occurrences
    fn sample<A: Clone + 'static, B: Clone + 'static>(
        behavior: Behavior<A>,
        event: Event<B>,
    ) -> Event<A> {
        Event {
            occurrences: event
                .occurrences
                .into_iter()
                .map(|(t, values)| {
                    let sampled = behavior.at(t);
                    (t, vec![sampled; values.len()])
                })
                .collect(),
        }
    }

    /// Switch behaviors on events
    fn switch<A: Clone + 'static>(
        initial: Behavior<A>,
        switches: Event<Behavior<A>>,
    ) -> Behavior<A> {
        Behavior::new(move |t| {
            // Find most recent switch before time t
            let current_behavior = switches
                .occurrences
                .range(..=t)
                .last()
                .and_then(|(_, behaviors)| behaviors.last())
                .unwrap_or(&initial);

            current_behavior.at(t)
        })
    }

    /// Integrate behavior over time
    fn integrate<A>(behavior: Behavior<A>, dt: Duration) -> Behavior<A>
    where
        A: Clone + std::ops::Add<Output = A> + Default + 'static,
    {
        Behavior::new(move |t| {
            let start = t - dt;
            // Simplified: would need proper integration
            behavior.at(t)
        })
    }

    /// Derivative of behavior
    fn derivative<A>(behavior: Behavior<A>, dt: Duration) -> Behavior<A>
    where
        A: Clone + std::ops::Sub<Output = A> + 'static,
    {
        Behavior::new(move |t| {
            let current = behavior.at(t);
            let previous = behavior.at(t - dt);
            current - previous
        })
    }
}

/// Example: Mouse position tracking
#[derive(Clone, Debug)]
struct Point {
    x: f64,
    y: f64,
}

impl std::ops::Add for Point {
    type Output = Point;
    fn add(self, other: Point) -> Point {
        Point {
            x: self.x + other.x,
            y: self.y + other.y,
        }
    }
}

impl std::ops::Sub for Point {
    type Output = Point;
    fn sub(self, other: Point) -> Point {
        Point {
            x: self.x - other.x,
            y: self.y - other.y,
        }
    }
}

impl Default for Point {
    fn default() -> Self {
        Point { x: 0.0, y: 0.0 }
    }
}

fn mouse_tracking_example() {
    let start_time = Instant::now();

    // Behavior: mouse position over time
    let mouse_position = Behavior::new(|t: Time| {
        let elapsed = t.duration_since(start_time).as_secs_f64();
        Point {
            x: (elapsed * 100.0).sin() * 200.0 + 400.0,
            y: (elapsed * 100.0).cos() * 200.0 + 300.0,
        }
    });

    // Behavior: mouse velocity (derivative of position)
    let mouse_velocity = TemporalAlgebra::derivative(
        mouse_position.clone(),
        Duration::from_millis(16),
    );

    // Event: clicks
    let mut clicks = Event::new();
    clicks.emit(start_time + Duration::from_secs(1), ());
    clicks.emit(start_time + Duration::from_secs(2), ());

    // Sample position at clicks
    let click_positions = TemporalAlgebra::sample(mouse_position.clone(), clicks);

    // Behavior: distance from origin
    let distance_from_origin = mouse_position.map(|pos| {
        (pos.x * pos.x + pos.y * pos.y).sqrt()
    });

    // Sample at current time
    let now = Instant::now();
    let current_pos = mouse_position.at(now);
    let current_distance = distance_from_origin.at(now);

    println!("Position: {:?}", current_pos);
    println!("Distance: {}", current_distance);
}

Key Innovation: Temporal functors provide:

Automatic propagation: Changes flow through dependencies
Time-aware computation: Sample at any moment
Continuous + discrete: Unified model for behaviors and events
Declarative: Describe what, not when

Effect Handlers with Hexagonal Architecture

Innovation: Combine algebraic effect systems with ports & adapters, making effects first-class ports that can be mocked, tested, and composed.

Foundation

Effect as Port:

Effect E a = E (a → Port)

handle :: Effect E a → Port → Result a

Handler as Adapter:

Handler E P = E → P

compose :: Handler E₁ P₁ → Handler E₂ P₂ → Handler (E₁ + E₂) (P₁ × P₂)

Pattern: Effect Port System

/// Effect definition - describes what can happen
trait Effect {
    type Result;

    fn interpret<P: Port>(&self, port: &P) -> Self::Result;
}

/// Effect algebra - combine effects
enum EffectSum<E1: Effect, E2: Effect> {
    Left(E1),
    Right(E2),
}

impl<E1: Effect, E2: Effect> Effect for EffectSum<E1, E2> {
    type Result = Either<E1::Result, E2::Result>;

    fn interpret<P: Port>(&self, port: &P) -> Self::Result {
        match self {
            EffectSum::Left(e) => Either::Left(e.interpret(port)),
            EffectSum::Right(e) => Either::Right(e.interpret(port)),
        }
    }
}

enum Either<L, R> {
    Left(L),
    Right(R),
}

/// Database effect
enum DatabaseEffect {
    Query(String),
    Insert(String, Vec<u8>),
    Update(String, Vec<u8>),
    Delete(String),
}

impl Effect for DatabaseEffect {
    type Result = Result<Vec<u8>, String>;

    fn interpret<P: Port>(&self, port: &P) -> Self::Result {
        // Port would handle actual DB operations
        Ok(vec![])
    }
}

/// HTTP effect
enum HttpEffect {
    Get(String),
    Post(String, Vec<u8>),
}

impl Effect for HttpEffect {
    type Result = Result<Vec<u8>, String>;

    fn interpret<P: Port>(&self, port: &P) -> Self::Result {
        // Port would handle actual HTTP
        Ok(vec![])
    }
}

/// Logging effect
enum LogEffect {
    Debug(String),
    Info(String),
    Error(String),
}

impl Effect for LogEffect {
    type Result = ();

    fn interpret<P: Port>(&self, port: &P) -> Self::Result {
        // Port would handle actual logging
        ()
    }
}

/// Effect handler - interprets effects with port
struct EffectHandler<E: Effect, P: Port> {
    port: P,
    _effect: std::marker::PhantomData<E>,
}

impl<E: Effect, P: Port> EffectHandler<E, P> {
    fn new(port: P) -> Self {
        EffectHandler {
            port,
            _effect: std::marker::PhantomData,
        }
    }

    fn handle(&self, effect: E) -> E::Result {
        effect.interpret(&self.port)
    }
}

/// Free monad for effects
enum Free<E: Effect, A> {
    Pure(A),
    Impure(E, Box<dyn Fn(E::Result) -> Free<E, A>>),
}

impl<E: Effect, A> Free<E, A> {
    fn pure(a: A) -> Self {
        Free::Pure(a)
    }

    fn impure(effect: E, cont: Box<dyn Fn(E::Result) -> Free<E, A>>) -> Self {
        Free::Impure(effect, cont)
    }

    /// Run free monad with handler
    fn run<P: Port>(self, handler: &EffectHandler<E, P>) -> A {
        match self {
            Free::Pure(a) => a,
            Free::Impure(effect, cont) => {
                let result = handler.handle(effect);
                cont(result).run(handler)
            }
        }
    }

    /// Functor: map over result
    fn map<B, F>(self, f: F) -> Free<E, B>
    where
        F: Fn(A) -> B + 'static,
        A: 'static,
    {
        match self {
            Free::Pure(a) => Free::Pure(f(a)),
            Free::Impure(effect, cont) => Free::Impure(
                effect,
                Box::new(move |result| cont(result).map(&f)),
            ),
        }
    }

    /// Monad: bind effects
    fn flat_map<B, F>(self, f: F) -> Free<E, B>
    where
        F: Fn(A) -> Free<E, B> + 'static,
        A: 'static,
    {
        match self {
            Free::Pure(a) => f(a),
            Free::Impure(effect, cont) => Free::Impure(
                effect,
                Box::new(move |result| cont(result).flat_map(&f)),
            ),
        }
    }
}

/// Example: Application using effect system
type AppEffects = EffectSum<DatabaseEffect, EffectSum<HttpEffect, LogEffect>>;
type App<A> = Free<AppEffects, A>;

fn fetch_user(id: String) -> App<Option<Vec<u8>>> {
    // Query database
    Free::impure(
        EffectSum::Left(DatabaseEffect::Query(format!("SELECT * FROM users WHERE id = {}", id))),
        Box::new(|db_result| {
            match db_result {
                Either::Left(Ok(data)) => {
                    // Log success
                    Free::impure(
                        EffectSum::Right(EffectSum::Right(LogEffect::Info(
                            format!("Fetched user {}", id)
                        ))),
                        Box::new(move |_| Free::pure(Some(data))),
                    )
                }
                _ => Free::pure(None),
            }
        }),
    )
}

/// Test handler - mocks effects
struct TestHandler;

impl Port for TestHandler {
    type Request = ();
    type Response = ();
    type Error = ();

    fn call(&self, _req: ()) -> Result<(), ()> {
        Ok(())
    }
}

fn test_fetch_user() {
    let handler = EffectHandler::new(TestHandler);
    // let result = fetch_user("123".to_string()).run(&handler);
    // Would test with mocked effects
}

Key Innovation: Effect ports provide:

Testability: Mock effects for testing
Composition: Effects compose algebraically
Abstraction: Business logic independent of effects
Flexibility: Swap effect handlers at will

State Machines as Free Constructions

Innovation: Model finite state machines as free monads over state transition functors, enabling compositional state machine design with correctness guarantees.

Foundation

FSM as Free Monad:

data FSM s i o a
  = Pure a
  | Transition s i (o → FSM s i o a)

Initial algebra: FSM is free over transition functor

State Transition as Functor:

data TransitionF s i o a = Trans s i (o → a)

instance Functor (TransitionF s i o) where
  fmap f (Trans s i k) = Trans s i (f . k)

Pattern: Compositional State Machines

/// State transition functor
struct TransitionF<S, I, O> {
    state: S,
    input: I,
    continuation: Box<dyn Fn(O) -> ()>,
}

/// FSM as free monad
enum FSM<S, I, O, A> {
    Pure(A),
    Transition(S, I, Box<dyn Fn(O) -> FSM<S, I, O, A>>),
}

impl<S: Clone, I, O, A> FSM<S, I, O, A> {
    fn pure(a: A) -> Self {
        FSM::Pure(a)
    }

    fn transition(state: S, input: I, cont: Box<dyn Fn(O) -> FSM<S, I, O, A>>) -> Self {
        FSM::Transition(state, input, cont)
    }

    /// Functor: map over result
    fn map<B, F>(self, f: F) -> FSM<S, I, O, B>
    where
        F: Fn(A) -> B + 'static + Clone,
        A: 'static,
    {
        match self {
            FSM::Pure(a) => FSM::Pure(f(a)),
            FSM::Transition(state, input, cont) => {
                let f_clone = f.clone();
                FSM::Transition(
                    state,
                    input,
                    Box::new(move |output| cont(output).map(f_clone.clone())),
                )
            }
        }
    }

    /// Monad: compose state machines
    fn flat_map<B, F>(self, f: F) -> FSM<S, I, O, B>
    where
        F: Fn(A) -> FSM<S, I, O, B> + 'static + Clone,
        A: 'static,
    {
        match self {
            FSM::Pure(a) => f(a),
            FSM::Transition(state, input, cont) => {
                let f_clone = f.clone();
                FSM::Transition(
                    state,
                    input,
                    Box::new(move |output| cont(output).flat_map(f_clone.clone())),
                )
            }
        }
    }

    /// Run FSM with interpreter
    fn run<F>(self, mut handler: F) -> A
    where
        F: FnMut(&S, &I) -> O,
    {
        match self {
            FSM::Pure(a) => a,
            FSM::Transition(state, input, cont) => {
                let output = handler(&state, &input);
                cont(output).run(handler)
            }
        }
    }
}

/// Coproduct of FSMs - combine state machines
enum FSMSum<S1, I1, O1, S2, I2, O2, A> {
    Left(FSM<S1, I1, O1, A>),
    Right(FSM<S2, I2, O2, A>),
}

/// Product of FSMs - parallel state machines
struct FSMProduct<S1, I1, O1, S2, I2, O2, A> {
    left: FSM<S1, I1, O1, A>,
    right: FSM<S2, I2, O2, A>,
}

/// Example: Traffic light FSM
#[derive(Clone, Debug, PartialEq)]
enum TrafficLightState {
    Red,
    Yellow,
    Green,
}

#[derive(Clone, Debug)]
enum TrafficLightInput {
    Timer,
    EmergencyOverride,
}

#[derive(Clone, Debug)]
enum TrafficLightOutput {
    ChangeLight,
    SoundAlarm,
    NoOp,
}

fn traffic_light_fsm() -> FSM<TrafficLightState, TrafficLightInput, TrafficLightOutput, ()> {
    fn transition_from(
        state: TrafficLightState,
    ) -> FSM<TrafficLightState, TrafficLightInput, TrafficLightOutput, ()> {
        FSM::transition(
            state.clone(),
            TrafficLightInput::Timer,
            Box::new(move |output| {
                let next_state = match (state.clone(), output) {
                    (TrafficLightState::Red, TrafficLightOutput::ChangeLight) => {
                        TrafficLightState::Green
                    }
                    (TrafficLightState::Green, TrafficLightOutput::ChangeLight) => {
                        TrafficLightState::Yellow
                    }
                    (TrafficLightState::Yellow, TrafficLightOutput::ChangeLight) => {
                        TrafficLightState::Red
                    }
                    _ => state,
                };
                transition_from(next_state)
            }),
        )
    }

    transition_from(TrafficLightState::Red)
}

/// Example: Vending machine FSM
#[derive(Clone, Debug)]
enum VendingState {
    Idle,
    Accepting(u32), // Amount inserted
    Dispensing,
}

#[derive(Clone, Debug)]
enum VendingInput {
    InsertCoin(u32),
    SelectProduct(String),
    Cancel,
}

#[derive(Clone, Debug)]
enum VendingOutput {
    AcceptCoin,
    DispenseProduct(String),
    ReturnMoney(u32),
    ShowMessage(String),
}

fn vending_machine_fsm() -> FSM<VendingState, VendingInput, VendingOutput, ()> {
    fn process_state(
        state: VendingState,
    ) -> FSM<VendingState, VendingInput, VendingOutput, ()> {
        FSM::transition(
            state.clone(),
            VendingInput::InsertCoin(0), // Simplified
            Box::new(move |output| {
                match (state.clone(), output) {
                    (VendingState::Idle, VendingOutput::AcceptCoin) => {
                        process_state(VendingState::Accepting(25))
                    }
                    (VendingState::Accepting(amount), VendingOutput::DispenseProduct(_)) => {
                        process_state(VendingState::Dispensing)
                    }
                    (VendingState::Dispensing, VendingOutput::ShowMessage(_)) => {
                        process_state(VendingState::Idle)
                    }
                    _ => FSM::pure(()),
                }
            }),
        )
    }

    process_state(VendingState::Idle)
}

/// Compose FSMs - traffic light + pedestrian crossing
fn composed_traffic_system() {
    let traffic_light = traffic_light_fsm();
    // let pedestrian = pedestrian_fsm();

    // Compose: when pedestrian presses button, affect traffic light
    // This demonstrates FSM composition through coproduct
}

Key Innovation: FSM as free monad provides:

Composition: State machines compose naturally
Verification: Monad laws ensure correctness
Interpretation: Multiple interpreters (simulation, hardware, test)
Modularity: Build complex FSMs from simple ones

Reactive Domain Events as Natural Transformations

Innovation: Model domain events as natural transformations between bounded contexts, providing mathematical rigor to event-driven architectures.

Foundation

Domain Event as Natural Transformation:

Event η: Context C₁ ⇒ Context C₂

For all entities e in C₁:
  η_e: C₁(e) → C₂(e)

Naturality: C₂(f) ∘ η_e = η_e' ∘ C₁(f)

Event Stream as Adjunction:

Publisher ⊣ Subscriber

Hom(Publisher(E), S) ≅ Hom(E, Subscriber(S))

Pattern: Categorical Event System

/**
 * Domain event as natural transformation
 */
interface DomainEvent<C1 extends Context, C2 extends Context> {
  // For each entity type in C1, provide transformation to C2
  transform<E extends Entity>(entity: C1['entities'][E]): C2['entities'][E];

  // Verify naturality condition
  verifyNaturality<E1, E2>(
    f: (e1: C1['entities'][E1]) => C1['entities'][E2]
  ): boolean;
}

/**
 * Context interface
 */
interface Context {
  entities: Record<string, any>;
  operations: Record<string, Function>;
}

/**
 * Event stream - functor over time
 */
class EventStream<A> {
  private subscribers: Array<(value: A) => void> = [];

  constructor(private source: AsyncIterable<A>) {}

  /**
   * Functor: map over events
   */
  map<B>(f: (a: A) => B): EventStream<B> {
    const source = this.source;
    return new EventStream(
      (async function* () {
        for await (const value of source) {
          yield f(value);
        }
      })()
    );
  }

  /**
   * Filter events
   */
  filter(pred: (a: A) => boolean): EventStream<A> {
    const source = this.source;
    return new EventStream(
      (async function* () {
        for await (const value of source) {
          if (pred(value)) {
            yield value;
          }
        }
      })()
    );
  }

  /**
   * Merge event streams (coproduct)
   */
  merge(other: EventStream<A>): EventStream<A> {
    const source1 = this.source;
    const source2 = other.source;

    return new EventStream(
      (async function* () {
        const iter1 = source1[Symbol.asyncIterator]();
        const iter2 = source2[Symbol.asyncIterator]();

        let done1 = false;
        let done2 = false;

        while (!done1 || !done2) {
          const results = await Promise.race([
            done1 ? Promise.resolve({ done: true, value: undefined }) : iter1.next(),
            done2 ? Promise.resolve({ done: true, value: undefined }) : iter2.next(),
          ]);

          if (results.done) {
            if (!done1) done1 = true;
            else done2 = true;
          } else {
            yield results.value;
          }
        }
      })()
    );
  }

  /**
   * Subscribe to events
   */
  subscribe(handler: (value: A) => void): () => void {
    this.subscribers.push(handler);

    // Start consuming
    (async () => {
      for await (const value of this.source) {
        this.subscribers.forEach(sub => sub(value));
      }
    })();

    // Return unsubscribe function
    return () => {
      const index = this.subscribers.indexOf(handler);
      if (index > -1) {
        this.subscribers.splice(index, 1);
      }
    };
  }

  /**
   * Scan - accumulate events (catamorphism)
   */
  scan<B>(initial: B, f: (acc: B, value: A) => B): EventStream<B> {
    const source = this.source;
    return new EventStream(
      (async function* () {
        let acc = initial;
        for await (const value of source) {
          acc = f(acc, value);
          yield acc;
        }
      })()
    );
  }

  /**
   * Switch - change streams on event (monad)
   */
  switchMap<B>(f: (a: A) => EventStream<B>): EventStream<B> {
    const source = this.source;
    return new EventStream(
      (async function* () {
        for await (const value of source) {
          const inner = f(value);
          for await (const innerValue of inner.source) {
            yield innerValue;
          }
        }
      })()
    );
  }
}

/**
 * Event bus - natural transformation composer
 */
class EventBus {
  private transformations = new Map<
    string,
    Array<(event: any) => void>
  >();

  /**
   * Register natural transformation (event handler)
   */
  on<C1 extends Context, C2 extends Context>(
    eventType: string,
    transformation: DomainEvent<C1, C2>
  ): void {
    if (!this.transformations.has(eventType)) {
      this.transformations.set(eventType, []);
    }

    this.transformations.get(eventType)!.push((entity) => {
      return transformation.transform(entity);
    });
  }

  /**
   * Emit event (apply natural transformation)
   */
  emit<E>(eventType: string, entity: E): void {
    const handlers = this.transformations.get(eventType) || [];
    handlers.forEach(handler => handler(entity));
  }

  /**
   * Create event stream
   */
  stream<A>(eventType: string): EventStream<A> {
    const events: A[] = [];
    let resolve: ((value: A) => void) | null = null;

    this.on(eventType, {
      transform: (entity: A) => {
        events.push(entity);
        if (resolve) {
          resolve(entity);
          resolve = null;
        }
        return entity;
      },
      verifyNaturality: () => true,
    } as any);

    return new EventStream(
      (async function* () {
        let index = 0;
        while (true) {
          if (index < events.length) {
            yield events[index++];
          } else {
            await new Promise<A>(r => (resolve = r));
          }
        }
      })()
    );
  }
}

/**
 * Example: E-commerce event system
 */
interface OrderContext extends Context {
  entities: {
    Order: {
      id: string;
      items: Array<{ productId: string; quantity: number }>;
      total: number;
      status: 'pending' | 'confirmed' | 'shipped';
    };
  };
  operations: {
    placeOrder: (order: OrderContext['entities']['Order']) => void;
    confirmOrder: (orderId: string) => void;
  };
}

interface ShippingContext extends Context {
  entities: {
    Shipment: {
      orderId: string;
      address: string;
      trackingNumber?: string;
      status: 'preparing' | 'shipped' | 'delivered';
    };
  };
  operations: {
    createShipment: (shipment: ShippingContext['entities']['Shipment']) => void;
    updateTracking: (orderId: string, tracking: string) => void;
  };
}

/**
 * Natural transformation: Order Confirmed → Create Shipment
 */
class OrderConfirmedEvent implements DomainEvent<OrderContext, ShippingContext> {
  transform(order: OrderContext['entities']['Order']): ShippingContext['entities']['Shipment'] {
    return {
      orderId: order.id,
      address: '', // Would be fetched from order details
      status: 'preparing',
    };
  }

  verifyNaturality(): boolean {
    // Verify: shipping(f(order)) = f(shipping(order))
    return true;
  }
}

/**
 * Use the event system
 */
const eventBus = new EventBus();

// Register event handlers (natural transformations)
eventBus.on('OrderConfirmed', new OrderConfirmedEvent());

// Create reactive streams
const orderStream = eventBus.stream<OrderContext['entities']['Order']>('OrderConfirmed');
const shipmentStream = orderStream.map(order => ({
  orderId: order.id,
  address: '',
  status: 'preparing' as const,
}));

// Subscribe to derived events
shipmentStream.subscribe(shipment => {
  console.log('Creating shipment:', shipment);
  // Trigger shipping context operations
});

// Emit events
eventBus.emit('OrderConfirmed', {
  id: 'ORD-123',
  items: [{ productId: 'PROD-1', quantity: 2 }],
  total: 99.99,
  status: 'confirmed',
});

Key Innovation: Categorical events provide:

Correctness: Naturality ensures consistency
Composition: Events compose via natural transformation composition
Traceability: Track event flow through category theory
Decoupling: Contexts remain independent

Algebraic Protocols

Innovation: Design communication protocols as algebraic structures with equations that ensure protocol correctness.

Foundation

Protocol as Algebra:

Protocol P = (Messages, Composition, Laws)

Messages: Set of message types
Composition: Message sequencing
Laws: Valid message sequences

Protocol Refinement as Homomorphism:

Refine: Protocol P₁ → Protocol P₂

Preserves valid sequences

Pattern: Session Types as Algebras

/// Session type - protocol specification
trait SessionType {
    type Message;

    fn send(&mut self, msg: Self::Message) -> Result<(), String>;
    fn receive(&mut self) -> Result<Self::Message, String>;
    fn close(self);
}

/// Protocol algebra
enum Protocol<M> {
    End,
    Send(M, Box<Protocol<M>>),
    Receive(Box<dyn Fn(M) -> Protocol<M>>),
    Choice(Vec<Protocol<M>>),
    Branch(Vec<(String, Protocol<M>)>),
}

impl<M: Clone> Protocol<M> {
    /// Compose protocols sequentially
    fn then(self, other: Protocol<M>) -> Protocol<M> {
        match self {
            Protocol::End => other,
            Protocol::Send(msg, cont) => {
                Protocol::Send(msg, Box::new(cont.then(other)))
            }
            Protocol::Receive(cont) => {
                Protocol::Receive(Box::new(move |msg| {
                    let next = cont(msg.clone());
                    next.then(other.clone())
                }))
            }
            _ => self, // Simplified
        }
    }

    /// Parallel composition (interleaving)
    fn par(self, other: Protocol<M>) -> Protocol<M> {
        // Simplified: would need proper parallel composition
        self
    }

    /// Choice (client chooses)
    fn choice(options: Vec<Protocol<M>>) -> Protocol<M> {
        Protocol::Choice(options)
    }

    /// Branch (server chooses)
    fn branch(options: Vec<(String, Protocol<M>)>) -> Protocol<M> {
        Protocol::Branch(options)
    }
}

/// Example: HTTP-like protocol
#[derive(Clone, Debug)]
enum HttpMessage {
    Request { method: String, path: String },
    Response { status: u16, body: String },
    Close,
}

fn http_protocol() -> Protocol<HttpMessage> {
    Protocol::Send(
        HttpMessage::Request {
            method: "GET".to_string(),
            path: "/".to_string(),
        },
        Box::new(Protocol::Receive(Box::new(|response| match response {
            HttpMessage::Response { status, body } => {
                if status == 200 {
                    Protocol::End
                } else {
                    // Retry
                    http_protocol()
                }
            }
            _ => Protocol::End,
        }))),
    )
}

/// WebSocket protocol with ping/pong
fn websocket_protocol() -> Protocol<HttpMessage> {
    Protocol::Branch(vec![
        (
            "ping".to_string(),
            Protocol::Send(
                HttpMessage::Request {
                    method: "PING".to_string(),
                    path: "".to_string(),
                },
                Box::new(Protocol::Receive(Box::new(|_pong| {
                    websocket_protocol() // Continue
                }))),
            ),
        ),
        (
            "close".to_string(),
            Protocol::Send(HttpMessage::Close, Box::new(Protocol::End)),
        ),
    ])
}

/// Verify protocol compatibility
fn verify_protocol_refinement<M>(impl_proto: Protocol<M>, spec_proto: Protocol<M>) -> bool {
    // Check that implementation refines specification
    // Would verify that impl_proto accepts subset of spec_proto messages
    true
}

Key Innovation: Algebraic protocols ensure:

Correctness by construction: Types ensure valid sequences
Composability: Protocols compose via algebra operations
Verification: Laws can be mechanically checked
Evolution: Refinement preserves compatibility

Meta-Architecture: The Grand Synthesis

The Ultimate Pattern: Combine ALL patterns into a unified architectural framework.

The Categorical Software System

System = (Contexts, Ports, Events, State, Time, Effects, Protocols)

where:
  Contexts: Category of bounded contexts (functorial boundaries)
  Ports: Algebraic signatures (compositional interfaces)
  Events: Natural transformations (domain events)
  State: Free monads (compositional FSMs)
  Time: Temporal functors (FRP behaviors/events)
  Effects: Effect handlers (algebraic effects)
  Protocols: Session types (algebraic protocols)

Laws:
  1. Contexts compose via functors
  2. Ports form a symmetric monoidal category
  3. Events satisfy naturality
  4. States satisfy monad laws
  5. Time operations preserve causality
  6. Effects compose associatively
  7. Protocols refine via homomorphisms

Unified Architecture Framework

/// The grand synthesis - all patterns unified
struct CategoricalSystem<C, P, E, S, T, Eff, Pro> {
    // Contexts: bounded domains
    contexts: Vec<C>,
    context_maps: Vec<ContextMap<C, C>>,

    // Ports: algebraic interfaces
    ports: Vec<P>,
    adapters: Vec<Adapter<P, P>>,

    // Events: natural transformations
    events: EventBus,
    event_streams: Vec<EventStream<E>>,

    // State: free monads for FSMs
    state_machines: Vec<FSM<S, (), (), ()>>,

    // Time: temporal functors
    behaviors: Vec<Behavior<T>>,
    time_events: Vec<Event<T>>,

    // Effects: algebraic effects
    effects: Vec<Eff>,
    effect_handlers: Vec<EffectHandler<Eff, P>>,

    // Protocols: session types
    protocols: Vec<Protocol<Pro>>,
}

impl<C, P, E, S, T, Eff, Pro> CategoricalSystem<C, P, E, S, T, Eff, Pro> {
    /// Compose the entire system
    fn compose(&mut self) {
        // 1. Map between contexts (functors)
        for map in &self.context_maps {
            // Transform entities across boundaries
        }

        // 2. Connect ports (adapters)
        for adapter in &self.adapters {
            // Wire up interfaces
        }

        // 3. Route events (natural transformations)
        // self.event_streams transform between contexts

        // 4. Coordinate state (FSM composition)
        // State machines compose via free monad operations

        // 5. Handle time (FRP)
        // Behaviors and events propagate through system

        // 6. Interpret effects (handlers)
        // Effects executed through ports

        // 7. Verify protocols (session types)
        // Ensure communication correctness
    }

    /// Verify system properties
    fn verify_laws(&self) -> bool {
        // Check all categorical laws hold
        true
    }
}

Example: Real-World Application

/**
 * Complete e-commerce system using all patterns
 */

// 1. Contexts (categorical domains)
interface OrderContext extends Context { /* ... */ }
interface ShippingContext extends Context { /* ... */ }
interface PaymentContext extends Context { /* ... */ }

// 2. Ports (algebraic interfaces)
interface PaymentPort {
  charge(amount: number): Promise<Result<string, Error>>;
  refund(transactionId: string): Promise<Result<void, Error>>;
}

// 3. Events (natural transformations)
class OrderPlacedEvent implements DomainEvent<OrderContext, PaymentContext> {
  transform(order: OrderContext['entities']['Order']): PaymentContext['entities']['Transaction'] {
    return { orderId: order.id, amount: order.total, status: 'pending' };
  }
  verifyNaturality() { return true; }
}

// 4. State machines (free monads)
const orderStateMachine = FSM.transition('pending', 'place_order',
  output => FSM.transition('confirmed', 'confirm', /* ... */)
);

// 5. Time (FRP)
const orderUpdates = new Behavior(t => getCurrentOrders(t));
const orderEvents = new EventStream(orderUpdateSource);

// 6. Effects (algebraic)
type AppEffects = PaymentEffect | ShippingEffect | NotificationEffect;
const effectHandler = new EffectHandler(productionPort);

// 7. Protocols (session types)
const checkoutProtocol = Protocol.send('InitiateCheckout')
  .then(Protocol.receive(handlePaymentMethod))
  .then(Protocol.send('ConfirmOrder'));

// Compose into unified system
const ecommerceSystem = new CategoricalSystem({
  contexts: [orderContext, shippingContext, paymentContext],
  ports: [paymentPort, shippingPort],
  events: [orderPlacedEvent, orderConfirmedEvent],
  stateMachines: [orderStateMachine, paymentStateMachine],
  behaviors: [orderUpdates, inventoryLevels],
  effects: [paymentEffects, notificationEffects],
  protocols: [checkoutProtocol, shippingProtocol],
});

// Verify correctness
if (ecommerceSystem.verifyLaws()) {
  ecommerceSystem.compose();
  ecommerceSystem.run();
}

Conclusion: The Path Forward

What We’ve Achieved:

Algebraic Port Systems: Compositional integration with mathematical guarantees
Categorical Domain Boundaries: Precise context mapping via functors
Comonadic UI: Context-aware components with zipper navigation
Stream Profunctor Optics: Bidirectional data flow with type safety
Temporal Functors: Time-aware computation with automatic propagation
Effect Ports: Testable, composable effect systems
Free FSMs: Compositional state machines with verification
Categorical Events: Natural transformations for domain events
Algebraic Protocols: Correct-by-construction communication
Meta-Architecture: Unified framework combining all patterns

The Innovation:

By viewing software through multiple mathematical lenses simultaneously:

Category theory provides the composition framework
Algebra gives us equational reasoning
Functors enable transformation between domains
Comonads model context-dependent computation
Profunctors handle bidirectional data flow
Free constructions build compositional systems
Natural transformations ensure consistency

This creates software that is:

Mathematically sound: Proven correct by construction
Highly compositional: Parts combine seamlessly
Testable: Mock any component via substitution
Evolvable: Change propagates correctly
Understandable: Mathematical structure clarifies intent

The groundbreaking insight: Software architecture is applied category theory. By making this explicit, we unlock unprecedented levels of correctness, composability, and reasoning power.

End of Groundbreaking Patterns Appendix

Groundbreaking Patterns: Algebraic, Categorical, and Reactive Synthesis

Groundbreaking Patterns: Synthesis of Algebraic, Categorical, and Reactive Design

Table of Contents

Algebraic Port Systems

Foundation

Pattern: Composable Port Algebra

TypeScript: Algebraic Port System

Categorical Domain Boundaries

Foundation

Pattern: Functorial Context Mapping

Anti-Corruption Layer as Monad

Comonadic UI Architecture

Foundation

Pattern: Comonadic Component Tree

TypeScript: Comonadic React Components

Stream Processors as Profunctor Optics

Foundation

Pattern: Stream Optics

TypeScript: Profunctor Stream Processing

Temporal Functors for FRP

Foundation

Pattern: Temporal Algebra

Effect Handlers with Hexagonal Architecture

Foundation

Pattern: Effect Port System

State Machines as Free Constructions

Foundation

Pattern: Compositional State Machines

Reactive Domain Events as Natural Transformations

Foundation

Pattern: Categorical Event System

Algebraic Protocols

Foundation

Pattern: Session Types as Algebras

Meta-Architecture: The Grand Synthesis

The Categorical Software System

Unified Architecture Framework

Example: Real-World Application

Conclusion: The Path Forward